ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
141492-50-4 3,4- (एथिलीनडियोक्सी) फिनाइल आइसोथियोसाइनेट |
|
| उत्पाद का नाम | 3,4- (एथिलीनडियोक्सी) फिनाइल आइसोथियोसाइनेट |
| समानार्थी | ; 2,3-डायहाइड्रो -1,4-बेंजोडायक्सिन -6-वाईएल आइसोथियोसाइनेट; 6-isothiocyanato-2,3-dihydro-1,4-बेंजोडायऑक्सिन; |
| अंग्रेज | 3,4-(Ethylenedioxy)phenyl isothiocyanate;2,3-Dihydro-1,4-benzodioxin-6-yl isothiocyanate;6-isothiocyanato-2,3-dihydro-1,4-benzodioxine |
| आणविक फार्मूला | C9H7NO2S |
| आण्विक वजन | 193.2224 |
| InChI | InChI=1/C9H7NO2S/c13-6-10-7-1-2-8-9(5-7)12-4-3-11-8/h1-2,5H,3-4H2 |
| कैस रजिस्टी संख्या | 141492-50-4 |
| आणविक संरचना | ![]() |
| घनत्व | 1.31g/cm3 |
| गलनांक | 62℃ |
| उबलने का समय | 329.2°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.627 |
| फ्लैश प्वाइंट | 152.9°C |
| वाष्प का दबाव | 0.000345mmHg at 25°C |
| खतरा प्रतीक | |
| खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |