ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
141492-50-4 3،4- (اتیلن دی اکسی) فنیل ایزوتیوسیانات؛ ؛ 2،3-دی هیدرو-1،4-بنزودیوکسین-6-ایل ایزوتیوسیانات؛ 6-isothiocyanato-2،3-دی هیدرو-1،4-بنزودیوکسین؛ |
|
| نام محصول | 3،4- (اتیلن دی اکسی) فنیل ایزوتیوسیانات؛ ؛ 2،3-دی هیدرو-1،4-بنزودیوکسین-6-ایل ایزوتیوسیانات؛ 6-isothiocyanato-2،3-دی هیدرو-1،4-بنزودیوکسین؛ |
| نام انگلیسی | 3,4-(Ethylenedioxy)phenyl isothiocyanate;2,3-Dihydro-1,4-benzodioxin-6-yl isothiocyanate;6-isothiocyanato-2,3-dihydro-1,4-benzodioxine |
| میدان مغناطیسی | C9H7NO2S |
| وزن مولکولی | 193.2224 |
| InChI | InChI=1/C9H7NO2S/c13-6-10-7-1-2-8-9(5-7)12-4-3-11-8/h1-2,5H,3-4H2 |
| شماره سیایاس | 141492-50-4 |
| ساختار مولکولی | ![]() |
| تراکم | 1.31g/cm3 |
| نقطه ذوب | 62℃ |
| نقطه غلیان | 329.2°C at 760 mmHg |
| ضریب شکست | 1.627 |
| نقطه اشتعال | 152.9°C |
| فشار بخار | 0.000345mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |