ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23141-61-9 6-Methyl-5-nitroquinoline |
|
| उत्पाद का नाम | 6-Methyl-5-nitroquinoline |
| अंग्रेज | 6-Methyl-5-nitroquinoline;NSC 162892;6-methyl-5-nitro-isoquinoline |
| आणविक फार्मूला | C10H8N2O2 |
| आण्विक वजन | 188.18 |
| InChI | InChI=1/C10H8N2O2/c1-7-2-3-8-6-11-5-4-9(8)10(7)12(13)14/h2-6H,1H3 |
| कैस रजिस्टी संख्या | 23141-61-9 |
| EINECS | 245-447-4 |
| आणविक संरचना | ![]() |
| घनत्व | 1.298g/cm3 |
| गलनांक | 117℃ |
| उबलने का समय | 342.4°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.661 |
| फ्लैश प्वाइंट | 160.9°C |
| वाष्प का दबाव | 0.00015mmHg at 25°C |
| खतरा प्रतीक | |
| खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |