ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23141-61-9 6-Methyl-5-nitroquinoline |
|
| نام محصول | 6-Methyl-5-nitroquinoline |
| نام انگلیسی | 6-Methyl-5-nitroquinoline;NSC 162892;6-methyl-5-nitro-isoquinoline |
| میدان مغناطیسی | C10H8N2O2 |
| وزن مولکولی | 188.18 |
| InChI | InChI=1/C10H8N2O2/c1-7-2-3-8-6-11-5-4-9(8)10(7)12(13)14/h2-6H,1H3 |
| شماره سیایاس | 23141-61-9 |
| تعداد کمیسیون اروپایی | 245-447-4 |
| ساختار مولکولی | ![]() |
| تراکم | 1.298g/cm3 |
| نقطه ذوب | 117℃ |
| نقطه غلیان | 342.4°C at 760 mmHg |
| ضریب شکست | 1.661 |
| نقطه اشتعال | 160.9°C |
| فشار بخار | 0.00015mmHg at 25°C |
| خطر نمادها | |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |