ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30955-94-3 2-Acetyl-5-iodothiophene |
|
उत्पाद का नाम | 2-Acetyl-5-iodothiophene |
अंग्रेज | 2-Acetyl-5-iodothiophene;NSC 80387;1-(5-iodothiophen-2-yl)ethanone |
आणविक फार्मूला | C6H5IOS |
आण्विक वजन | 252.0728 |
InChI | InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
कैस रजिस्टी संख्या | 30955-94-3 |
आणविक संरचना | ![]() |
घनत्व | 1.902g/cm3 |
उबलने का समय | 306.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.637 |
फ्लैश प्वाइंट | 139°C |
वाष्प का दबाव | 0.000785mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |