ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30955-94-3 2-Acetyl-5-iodothiophene |
|
Nama produk | 2-Acetyl-5-iodothiophene |
Nama Inggeris | 2-Acetyl-5-iodothiophene;NSC 80387;1-(5-iodothiophen-2-yl)ethanone |
MF | C6H5IOS |
Berat Molekul | 252.0728 |
InChI | InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
CAS NO | 30955-94-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.902g/cm3 |
Titik didih | 306.2°C at 760 mmHg |
Indeks bias | 1.637 |
Titik nyala | 139°C |
Tekanan wap | 0.000785mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |