ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4572-03-6 3-(4-methylpiperazin-1-yl)propylamine |
|
उत्पाद का नाम | 3-(4-methylpiperazin-1-yl)propylamine |
अंग्रेज | 3-(4-methylpiperazin-1-yl)propylamine;1-Piperazinepropanamine, 4-methyl-;3-(4-Methylpiperazin-1-yl)propan-1-amine;4-(3-Aminopropyl)-1-methylpiperazine;N-(.gamma.-Aminopropyl)-N'-methylpiperazine;N-Methyl-N'-(.gamma.-aminopropyl)piperazine;N-Methyl-N'-(3-aminopropyl)piperazine;N-Methyl-N'-(gamma-aminopropyl)piperazine;Piperazine, 1-(3-aminopropyl)-4-methyl-;1-(3-ammoniopropyl)-4-methylpiperazinediium |
आणविक फार्मूला | C8H22N3 |
आण्विक वजन | 160.2787 |
InChI | InChI=1/C8H19N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2-9H2,1H3/p+3 |
कैस रजिस्टी संख्या | 4572-03-6 |
EINECS | 224-954-4 |
आणविक संरचना | ![]() |
उबलने का समय | 230°C at 760 mmHg |
फ्लैश प्वाइंट | 92°C |
वाष्प का दबाव | 0.0674mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |