ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4572-03-6 3-(4-methylpiperazin-1-yl)propylamine |
|
اسم المنتج | 3-(4-methylpiperazin-1-yl)propylamine |
الاسم بالانجليزية | 3-(4-methylpiperazin-1-yl)propylamine;1-Piperazinepropanamine, 4-methyl-;3-(4-Methylpiperazin-1-yl)propan-1-amine;4-(3-Aminopropyl)-1-methylpiperazine;N-(.gamma.-Aminopropyl)-N'-methylpiperazine;N-Methyl-N'-(.gamma.-aminopropyl)piperazine;N-Methyl-N'-(3-aminopropyl)piperazine;N-Methyl-N'-(gamma-aminopropyl)piperazine;Piperazine, 1-(3-aminopropyl)-4-methyl-;1-(3-ammoniopropyl)-4-methylpiperazinediium |
الصيغة الجزيئية | C8H22N3 |
الوزن الجزيئي الغرامي | 160.2787 |
InChI | InChI=1/C8H19N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2-9H2,1H3/p+3 |
إستراتيجية المساعدة القطرية | 4572-03-6 |
المفوضية الأوروبية رقم | 224-954-4 |
بنية جزيئية | ![]() |
نقطة الغليان | 230°C at 760 mmHg |
نقطة الوميض | 92°C |
ضغط البخار | 0.0674mmHg at 25°C |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |