ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
63767-86-2 A mixture of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane |
|
| उत्पाद का नाम | A mixture of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane |
| अंग्रेज | A mixture of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane;Cyclohexanemethanol, alpha-methyl-4-(1-methylethyl)-;1-(4-Isopropylcyclohexyl) ethanol;1-[4-(propan-2-yl)cyclohexyl]ethanol;Mugetanol |
| आणविक फार्मूला | C11H22O |
| आण्विक वजन | 170.2918 |
| InChI | InChI=1/C11H22O/c1-8(2)10-4-6-11(7-5-10)9(3)12/h8-12H,4-7H2,1-3H3 |
| कैस रजिस्टी संख्या | 63767-86-2 |
| EINECS | 407-640-3 |
| आणविक संरचना | ![]() |
| घनत्व | 0.888g/cm3 |
| उबलने का समय | 240°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.458 |
| फ्लैश प्वाइंट | 105.9°C |
| वाष्प का दबाव | 0.00678mmHg at 25°C |
| MSDS | |