ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
63767-86-2 A mixture of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane |
|
Ürün Adı | A mixture of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane |
ingilizce adı | A mixture of diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane;Cyclohexanemethanol, alpha-methyl-4-(1-methylethyl)-;1-(4-Isopropylcyclohexyl) ethanol;1-[4-(propan-2-yl)cyclohexyl]ethanol;Mugetanol |
Moleküler Formülü | C11H22O |
Molekül Ağırlığı | 170.2918 |
InChI | InChI=1/C11H22O/c1-8(2)10-4-6-11(7-5-10)9(3)12/h8-12H,4-7H2,1-3H3 |
CAS kayıt numarası | 63767-86-2 |
EINECS | 407-640-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.888g/cm3 |
Kaynama noktası | 240°C at 760 mmHg |
Kırılma indisi | 1.458 |
Alevlenme noktası | 105.9°C |
Buhar basıncı | 0.00678mmHg at 25°C |
MSDS |