ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68583-52-8 Decanoic एसिड, octanoic एसिड और triethylene ग्लाइकोल के साथ मिश्रित diesters |
|
उत्पाद का नाम | Decanoic एसिड, octanoic एसिड और triethylene ग्लाइकोल के साथ मिश्रित diesters |
समानार्थी | कैप्रिलिक, कैप्रिक एसिड, ट्राइथिलीन ग्लाइकोल डायस्टर; Decanoic एसिड octanoic एसिड और triethylene ग्लाइकोल के साथ मिश्रित diesters; डिकैनोइक एसिड, 2- [2- (2-हाइड्रॉक्सीएथॉक्सी) एथॉक्सी] इथेनॉल, ऑक्टेनोइक एसिड; |
अंग्रेज | Decanoic acid, mixed diesters with octanoic acid and triethylene glycol;Caprylic, capric acid, triethylene glycol diester;Decanoic acid mixed diesters with octanoic acid and triethylene glycol;decanoic acid,2-[2-(2-hydroxyethoxy)ethoxy]ethanol,octanoic acid |
आणविक फार्मूला | C24H50O8 |
आण्विक वजन | 466.649 |
InChI | InChI=1/C10H20O2.C8H16O2.C6H14O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;7-1-3-9-5-6-10-4-2-8/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);7-8H,1-6H2 |
कैस रजिस्टी संख्या | 68583-52-8 |
EINECS | 271-517-9 |
आणविक संरचना | ![]() |
उबलने का समय | 269.6°C at 760 mmHg |
फ्लैश प्वाइंट | 121.8°C |
वाष्प का दबाव | 0.00355mmHg at 25°C |
MSDS |