ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68583-52-8 Asid Decanoic, diester campuran dengan asid octanoic dan triethylene glycol |
|
Nama produk | Asid Decanoic, diester campuran dengan asid octanoic dan triethylene glycol |
Sinonim | Caprylic, asid capric, trietilene glycol diester; Asid decanoic bercampur diester dengan asid octanoic dan triethylene glycol; asid decanoic,2-[2-(2-hydroxyethoxy)ethoxy]etanol,asid octanoic; |
Nama Inggeris | Decanoic acid, mixed diesters with octanoic acid and triethylene glycol;Caprylic, capric acid, triethylene glycol diester;Decanoic acid mixed diesters with octanoic acid and triethylene glycol;decanoic acid,2-[2-(2-hydroxyethoxy)ethoxy]ethanol,octanoic acid |
MF | C24H50O8 |
Berat Molekul | 466.649 |
InChI | InChI=1/C10H20O2.C8H16O2.C6H14O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;7-1-3-9-5-6-10-4-2-8/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);7-8H,1-6H2 |
CAS NO | 68583-52-8 |
EINECS | 271-517-9 |
Struktur Molekul | ![]() |
Titik didih | 269.6°C at 760 mmHg |
Titik nyala | 121.8°C |
Tekanan wap | 0.00355mmHg at 25°C |
MSDS |