ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-64-9 2-Chloro-6-methylphenol |
|
| उत्पाद का नाम | 2-Chloro-6-methylphenol |
| अंग्रेज | 2-Chloro-6-methylphenol;2-Chloro-6-methylphenol,98%;6-Chloro-o-cresol (OH=1);6-Chloro-o-cresol |
| आणविक फार्मूला | C7H7ClO |
| आण्विक वजन | 142.5829 |
| InChI | InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
| कैस रजिस्टी संख्या | 87-64-9 |
| EINECS | 201-760-8 |
| आणविक संरचना | ![]() |
| घनत्व | 1.228g/cm3 |
| उबलने का समय | 200.4°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.565 |
| फ्लैश प्वाइंट | 75°C |
| वाष्प का दबाव | 0.229mmHg at 25°C |
| खतरे के कोड | R21/22##Harmful in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |