ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-64-9 2-Chloro-6-methylphenol |
|
| Nama produk | 2-Chloro-6-methylphenol |
| Nama Inggeris | 2-Chloro-6-methylphenol;2-Chloro-6-methylphenol,98%;6-Chloro-o-cresol (OH=1);6-Chloro-o-cresol |
| MF | C7H7ClO |
| Berat Molekul | 142.5829 |
| InChI | InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
| CAS NO | 87-64-9 |
| EINECS | 201-760-8 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.228g/cm3 |
| Titik didih | 200.4°C at 760 mmHg |
| Indeks bias | 1.565 |
| Titik nyala | 75°C |
| Tekanan wap | 0.229mmHg at 25°C |
| Kod Risiko | R21/22##Harmful in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |