ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93918-99-1 3,7-डायहाइड्रो -1,3-डाइमिथाइल-1 एच-प्यूरीन-2,6-डायोन, 2- (मिथाइलैमिनो) इथेनॉल (1: 1) के साथ यौगिक |
|
उत्पाद का नाम | 3,7-डायहाइड्रो -1,3-डाइमिथाइल-1 एच-प्यूरीन-2,6-डायोन, 2- (मिथाइलैमिनो) इथेनॉल (1: 1) के साथ यौगिक |
समानार्थी | 3,7-डायहाइड्रो -1,3-डाइमिथाइल-1 एच-प्यूरीन-2,6-डायोन, 2- (मिथाइलैमिनो) इथेनॉल (1: 1) के साथ यौगिक; 1,3-डाइमिथाइल-9H-प्यूरीन-2,6-डायोन; 2-मिथाइलैमिनोथेनॉल; |
अंग्रेज | 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 2-(methylamino)ethanol (1:1);3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 2-(methylamino)ethanol (1:1);1,3-dimethyl-9H-purine-2,6-dione; 2-methylaminoethanol |
आणविक फार्मूला | C10H17N5O3 |
आण्विक वजन | 255.2737 |
InChI | InChI=1/C7H8N4O2.C3H9NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4-2-3-5/h3H,1-2H3,(H,8,9);4-5H,2-3H2,1H3 |
कैस रजिस्टी संख्या | 93918-99-1 |
EINECS | 299-981-8 |
आणविक संरचना | ![]() |
उबलने का समय | 547.2°C at 760 mmHg |
फ्लैश प्वाइंट | 284.7°C |
वाष्प का दबाव | 8.28E-13mmHg at 25°C |
MSDS |