ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93918-99-1 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, kompaun dengan 2-(methylamino)etanol (1:1) |
|
Nama produk | 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, kompaun dengan 2-(methylamino)etanol (1:1) |
Sinonim | 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, kompaun dengan 2-(methylamino)etanol (1:1); 1,3-dimethyl-9H-purine-2,6-dione; 2-methylaminoethanol; |
Nama Inggeris | 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 2-(methylamino)ethanol (1:1);3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 2-(methylamino)ethanol (1:1);1,3-dimethyl-9H-purine-2,6-dione; 2-methylaminoethanol |
MF | C10H17N5O3 |
Berat Molekul | 255.2737 |
InChI | InChI=1/C7H8N4O2.C3H9NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-4-2-3-5/h3H,1-2H3,(H,8,9);4-5H,2-3H2,1H3 |
CAS NO | 93918-99-1 |
EINECS | 299-981-8 |
Struktur Molekul | ![]() |
Titik didih | 547.2°C at 760 mmHg |
Titik nyala | 284.7°C |
Tekanan wap | 8.28E-13mmHg at 25°C |
MSDS |