ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1878-49-5 (2-Methylphenoxy)acetic acid |
|
نام محصول | (2-Methylphenoxy)acetic acid |
نام انگلیسی | (2-Methylphenoxy)acetic acid;2-Methylphenoxyacetic acid;(o-Tolyloxy)-acetic acid;(2-methylphenoxy)acetate |
میدان مغناطیسی | C9H9O3 |
وزن مولکولی | 165.1665 |
InChI | InChI=1/C9H10O3/c1-7-4-2-3-5-8(7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
شماره سیایاس | 1878-49-5 |
تعداد کمیسیون اروپایی | 217-517-4 |
ساختار مولکولی | ![]() |
نقطه ذوب | 152-154℃ |
نقطه غلیان | 288.4°C at 760 mmHg |
نقطه اشتعال | 115.7°C |
فشار بخار | 0.00109mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |