Chemindex >1878-49-5
MY ▼
1878-49-5 (2-Methylphenoxy)acetic acid |
|
| Nama produk | (2-Methylphenoxy)acetic acid |
| Nama Inggeris | (2-Methylphenoxy)acetic acid;2-Methylphenoxyacetic acid;(o-Tolyloxy)-acetic acid;(2-methylphenoxy)acetate |
| MF | C9H9O3 |
| Berat Molekul | 165.1665 |
| InChI | InChI=1/C9H10O3/c1-7-4-2-3-5-8(7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| CAS NO | 1878-49-5 |
| EINECS | 217-517-4 |
| Struktur Molekul |  |
| Titik lebur | 152-154℃ |
| Titik didih | 288.4°C at 760 mmHg |
| Titik nyala | 115.7°C |
| Tekanan wap | 0.00109mmHg at 25°C |
| Cinta bahaya |  Xi##Irritant:; |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 