ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2008-46-0 triethylammonium (2،4،5-trichlorophenoxy) استات؛ 2،4،5-T-triethylammonium [ISO]؛ 2،4،5-T نمک تری اتیلن امین؛ 2،4،5-T-triethylammonium؛ 2،4،5-Trichlorophenoxyacetic اسید نمک تری اتیل امین؛ کاسول شماره881K؛ EPA افت کش کد شیمیایی 082034؛ اسید استیک، (2،4،5-trichlorophenoxy)-، compd.با N، N-diethylethanamine (1:1)؛ 2،4،5-T تری اتیل امین؛ اسید استیک، (2،4،5-trichlorophenoxy)-، compd.با N، N-diethylethanamine؛ (2،4،5-trichlorophenoxy) اسید استیک - N،N-diethylethanamine (1:1)؛ |
|
| نام محصول | triethylammonium (2،4،5-trichlorophenoxy) استات؛ 2،4،5-T-triethylammonium [ISO]؛ 2،4،5-T نمک تری اتیلن امین؛ 2،4،5-T-triethylammonium؛ 2،4،5-Trichlorophenoxyacetic اسید نمک تری اتیل امین؛ کاسول شماره881K؛ EPA افت کش کد شیمیایی 082034؛ اسید استیک، (2،4،5-trichlorophenoxy)-، compd.با N، N-diethylethanamine (1:1)؛ 2،4،5-T تری اتیل امین؛ اسید استیک، (2،4،5-trichlorophenoxy)-، compd.با N، N-diethylethanamine؛ (2،4،5-trichlorophenoxy) اسید استیک - N،N-diethylethanamine (1:1)؛ |
| نام انگلیسی | triethylammonium (2,4,5-trichlorophenoxy)acetate;2,4,5-T-triethylammonium [ISO];2,4,5-T triethylamine salt;2,4,5-T-triethylammonium;2,4,5-Trichlorophenoxyacetic acid triethylamine salt;Caswell No. 881K;EPA Pesticide Chemical Code 082034;Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N,N-diethylethanamine (1:1);2,4,5-T Triethylamine;Acetic acid, (2,4,5-trichlorophenoxy)-, compd. with N,N-diethylethanamine;(2,4,5-trichlorophenoxy)acetic acid - N,N-diethylethanamine (1:1) |
| میدان مغناطیسی | C14H20Cl3NO3 |
| وزن مولکولی | 356.6725 |
| InChI | InChI=1/C8H5Cl3O3.C6H15N/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;1-4-7(5-2)6-3/h1-2H,3H2,(H,12,13);4-6H2,1-3H3 |
| شماره سیایاس | 2008-46-0 |
| تعداد کمیسیون اروپایی | 217-917-9 |
| ساختار مولکولی | ![]() |
| نقطه غلیان | 376.3°C at 760 mmHg |
| نقطه اشتعال | 181.4°C |
| فشار بخار | 2.48E-06mmHg at 25°C |
| MSDS | |