ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28052-84-8 DL-5-Methoxytryptophan |
|
نام محصول | DL-5-Methoxytryptophan |
نام انگلیسی | DL-5-Methoxytryptophan;DL-5-Methoxytryptophane;5-Methoxy-DL-tryptophan;5-methoxytryptophan;5-methoxy-D-tryptophan |
میدان مغناطیسی | C12H14N2O3 |
وزن مولکولی | 234.2512 |
InChI | InChI=1/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16)/t10-/m1/s1 |
شماره سیایاس | 28052-84-8 |
تعداد کمیسیون اروپایی | 248-800-0 |
ساختار مولکولی | ![]() |
تراکم | 1.347g/cm3 |
نقطه ذوب | 258-261℃ |
نقطه غلیان | 478.3°C at 760 mmHg |
ضریب شکست | 1.663 |
نقطه اشتعال | 243.1°C |
فشار بخار | 5.87E-10mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |