ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28052-84-8 DL-5-Methoxytryptophan |
|
Naam product | DL-5-Methoxytryptophan |
Engelse naam | DL-5-Methoxytryptophan;DL-5-Methoxytryptophane;5-Methoxy-DL-tryptophan;5-methoxytryptophan;5-methoxy-D-tryptophan |
MF | C12H14N2O3 |
Molecuulgewicht | 234.2512 |
InChI | InChI=1/C12H14N2O3/c1-17-8-2-3-11-9(5-8)7(6-14-11)4-10(13)12(15)16/h2-3,5-6,10,14H,4,13H2,1H3,(H,15,16)/t10-/m1/s1 |
CAS-nummer | 28052-84-8 |
EINECS | 248-800-0 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.347g/cm3 |
Smeltpunt | 258-261℃ |
Kookpunt | 478.3°C at 760 mmHg |
Brekingsindex | 1.663 |
Vlampunt | 243.1°C |
Dampdruk | 5.87E-10mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |