ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-67-4 3-fluoropropiophenone |
|
| نام محصول | 3-fluoropropiophenone |
| نام انگلیسی | 3-fluoropropiophenone;3'-FLUOROPROPIOPHENONE;1-(3-fluorophenyl)propan-1-one |
| میدان مغناطیسی | C9H9FO |
| وزن مولکولی | 152.1656 |
| InChI | InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| شماره سیایاس | 455-67-4 |
| ساختار مولکولی | ![]() |
| تراکم | 1.074g/cm3 |
| نقطه غلیان | 209.8°C at 760 mmHg |
| ضریب شکست | 1.489 |
| نقطه اشتعال | 79.8°C |
| فشار بخار | 0.199mmHg at 25°C |
| کدهای خطر | R36/38##Irritating to eyes and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |