ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-67-4 3-fluoropropiophenone |
|
| Nazwa produktu: | 3-fluoropropiophenone |
| Angielska nazwa | 3-fluoropropiophenone;3'-FLUOROPROPIOPHENONE;1-(3-fluorophenyl)propan-1-one |
| MF | C9H9FO |
| Masie cząsteczkowej | 152.1656 |
| InChI | InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| Nr CAS | 455-67-4 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.074g/cm3 |
| Temperatura wrzenia | 209.8°C at 760 mmHg |
| Współczynnik załamania | 1.489 |
| Temperatura zapłonu | 79.8°C |
| Ciśnienie pary | 0.199mmHg at 25°C |
| Kody ryzyka | R36/38##Irritating to eyes and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |