ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
588-43-2 tributyl orthoformate |
|
| نام محصول | tributyl orthoformate |
| نام انگلیسی | tributyl orthoformate;1-(Dibutoxymethoxy)butane;1,1',1''-(Methylidynetris(oxy))tributane;Butane, 1,1',1''-(methylidynetris(oxy))tris-;butane, 1,1',1''-[methylidynetris(oxy)]tris-;Orthoformic acid, tributyl ester;Orthoformic acid, tributyl ester (8CI) |
| میدان مغناطیسی | C13H28O3 |
| وزن مولکولی | 232.3596 |
| InChI | InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
| شماره سیایاس | 588-43-2 |
| تعداد کمیسیون اروپایی | 209-618-7 |
| ساختار مولکولی | ![]() |
| تراکم | 0.884g/cm3 |
| نقطه غلیان | 262.7°C at 760 mmHg |
| ضریب شکست | 1.427 |
| نقطه اشتعال | 96.3°C |
| فشار بخار | 0.0175mmHg at 25°C |
| توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |