ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
588-43-2 tributyl orthoformate |
|
| Nome do produto | tributyl orthoformate |
| Nome em inglês | tributyl orthoformate;1-(Dibutoxymethoxy)butane;1,1',1''-(Methylidynetris(oxy))tributane;Butane, 1,1',1''-(methylidynetris(oxy))tris-;butane, 1,1',1''-[methylidynetris(oxy)]tris-;Orthoformic acid, tributyl ester;Orthoformic acid, tributyl ester (8CI) |
| Fórmula molecular | C13H28O3 |
| Peso Molecular | 232.3596 |
| InChI | InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
| CAS Registry Number | 588-43-2 |
| EINECS | 209-618-7 |
| Estrutura Molecular | ![]() |
| Densidade | 0.884g/cm3 |
| Ponto de ebulição | 262.7°C at 760 mmHg |
| índice de refração | 1.427 |
| O ponto de inflamação | 96.3°C |
| Pressão de vapor | 0.0175mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |