ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68855-23-2 بنزنامین، ar،ar'-methylenebis [ar-chloro-، محصولات واکنش با ar،ar'-methylenebis [بنزنامین] و TDI؛ بنزنامین، ar،ar'-methylenebis (ar-chloro-، محصولات واکنش با ar،ar'-methylenebis (بنزنامین) و TDI؛ 2- [(3-amino-2-chloro-phenyl) متیل] -6-chloro-aniline؛ 2- [(2-امینوفنیل) متیل] انیلین؛ 1،3-diisocyanato-2-متیل بنزن؛ |
|
نام محصول | بنزنامین، ar،ar'-methylenebis [ar-chloro-، محصولات واکنش با ar،ar'-methylenebis [بنزنامین] و TDI؛ بنزنامین، ar،ar'-methylenebis (ar-chloro-، محصولات واکنش با ar،ar'-methylenebis (بنزنامین) و TDI؛ 2- [(3-amino-2-chloro-phenyl) متیل] -6-chloro-aniline؛ 2- [(2-امینوفنیل) متیل] انیلین؛ 1،3-diisocyanato-2-متیل بنزن؛ |
نام انگلیسی | Benzenamine, ar,ar'-methylenebis[ar-chloro-, reaction products with ar,ar'-methylenebis[benzenamine] and TDI;Benzenamine, ar,ar'-methylenebis(ar-chloro-, reaction products with ar,ar'-methylenebis(benzenamine) and TDI;2-[(3-amino-2-chloro-phenyl)methyl]-6-chloro-aniline; 2-[(2-aminophenyl)methyl]aniline; 1,3-diisocyanato-2-methyl-benzene |
میدان مغناطیسی | C35H32Cl2N6O2 |
وزن مولکولی | 639.5736 |
InChI | InChI=1/C13H12Cl2N2.C13H14N2.C9H6N2O2/c14-10-5-1-4-9(13(10)17)7-8-3-2-6-11(16)12(8)15;14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15;1-7-8(10-5-12)3-2-4-9(7)11-6-13/h1-6H,7,16-17H2;1-8H,9,14-15H2;2-4H,1H3 |
شماره سیایاس | 68855-23-2 |
تعداد کمیسیون اروپایی | 272-471-2 |
ساختار مولکولی | ![]() |
نقطه غلیان | 416.1°C at 760 mmHg |
نقطه اشتعال | 205.4°C |
فشار بخار | 3.93E-07mmHg at 25°C |
MSDS |