ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68855-23-2 Benzenamine, ar,ar'-methylenebis[ar-chloro-, منتجات التفاعل مع ar,ar'-methylenebis[benzenamine] و TDI |
|
اسم المنتج | Benzenamine, ar,ar'-methylenebis[ar-chloro-, منتجات التفاعل مع ar,ar'-methylenebis[benzenamine] و TDI |
الاسم المستعار | Benzenamine, ar,ar'-methylenebis(ar-chloro-, منتجات التفاعل مع ar,ar'-methylenebis(benzenamine) و TDI; 2- [(3-أمينو-2-كلورو-فينيل)ميثيل] -6-كلورو-أنيلين ؛ 2- [(2-أمينوفينيل) ميثيل] أنيلين ؛ 1،3-ديسوسياناتو-2-ميثيل بنزين ؛ |
الاسم بالانجليزية | Benzenamine, ar,ar'-methylenebis[ar-chloro-, reaction products with ar,ar'-methylenebis[benzenamine] and TDI;Benzenamine, ar,ar'-methylenebis(ar-chloro-, reaction products with ar,ar'-methylenebis(benzenamine) and TDI;2-[(3-amino-2-chloro-phenyl)methyl]-6-chloro-aniline; 2-[(2-aminophenyl)methyl]aniline; 1,3-diisocyanato-2-methyl-benzene |
الصيغة الجزيئية | C35H32Cl2N6O2 |
الوزن الجزيئي الغرامي | 639.5736 |
InChI | InChI=1/C13H12Cl2N2.C13H14N2.C9H6N2O2/c14-10-5-1-4-9(13(10)17)7-8-3-2-6-11(16)12(8)15;14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15;1-7-8(10-5-12)3-2-4-9(7)11-6-13/h1-6H,7,16-17H2;1-8H,9,14-15H2;2-4H,1H3 |
إستراتيجية المساعدة القطرية | 68855-23-2 |
المفوضية الأوروبية رقم | 272-471-2 |
بنية جزيئية | ![]() |
نقطة الغليان | 416.1°C at 760 mmHg |
نقطة الوميض | 205.4°C |
ضغط البخار | 3.93E-07mmHg at 25°C |
MSDS |