ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7355-22-8 5-Bromo-§ |
|
نام محصول | 5-Bromo-§ |
نام انگلیسی | 5-Bromo-§5-Bromo-2,4-dihydroxybenzoic acid monohydrate;5-bromo-2,4-dihydroxybenzoic acid |
میدان مغناطیسی | C7H5BrO4 |
وزن مولکولی | 233.0162 |
InChI | InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
شماره سیایاس | 7355-22-8 |
تعداد کمیسیون اروپایی | 230-881-9 |
ساختار مولکولی | ![]() |
تراکم | 2.026g/cm3 |
نقطه غلیان | 436.7°C at 760 mmHg |
ضریب شکست | 1.703 |
نقطه اشتعال | 217.9°C |
فشار بخار | 2.13E-08mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |