ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7355-22-8 5-Bromo-§ |
|
Nama produk | 5-Bromo-§ |
Nama Inggeris | 5-Bromo-§5-Bromo-2,4-dihydroxybenzoic acid monohydrate;5-bromo-2,4-dihydroxybenzoic acid |
MF | C7H5BrO4 |
Berat Molekul | 233.0162 |
InChI | InChI=1/C7H5BrO4/c8-4-1-3(7(11)12)5(9)2-6(4)10/h1-2,9-10H,(H,11,12) |
CAS NO | 7355-22-8 |
EINECS | 230-881-9 |
Struktur Molekul | ![]() |
Kepadatan | 2.026g/cm3 |
Titik didih | 436.7°C at 760 mmHg |
Indeks bias | 1.703 |
Titik nyala | 217.9°C |
Tekanan wap | 2.13E-08mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |