ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-84-6 (1S-cis) -1،2،3،4،5،6،7،8-octahydro-7-isopropylidene-1،4-dimethylazulene؛ گوایین؛ 1،2،3،4،5،6،7،8-Octahydro-1،4-dimethyl-7- (1-methylethylidene) -azulene، (1S،cis)؛ Azulene، 1،2،3،4،5،6،7،8-octahydro-1،4-dimethyl-7- (1-methylethylidene)-، (1S-cis)-؛ Guaia-1 (5)، 7 (11) -diene؛ (1S-cis) -1،2،3،4،5،6،7،8-Octahydro-7-isopropylidene-1،4-dimethylazulene؛ Azulene، 1،2،3،4،5،6،7،8-octahydro-1،4-dimethyl-7- (1-methylethylidene)-، (1S،4S)-؛ Guaiene، بتا؛ 1،4-دی متیل-7- (پروپان-2-ایلین) -1،2،3،4،5،6،7،8-اکتا هیدروازولین؛ |
|
| نام محصول | (1S-cis) -1،2،3،4،5،6،7،8-octahydro-7-isopropylidene-1،4-dimethylazulene؛ گوایین؛ 1،2،3،4،5،6،7،8-Octahydro-1،4-dimethyl-7- (1-methylethylidene) -azulene، (1S،cis)؛ Azulene، 1،2،3،4،5،6،7،8-octahydro-1،4-dimethyl-7- (1-methylethylidene)-، (1S-cis)-؛ Guaia-1 (5)، 7 (11) -diene؛ (1S-cis) -1،2،3،4،5،6،7،8-Octahydro-7-isopropylidene-1،4-dimethylazulene؛ Azulene، 1،2،3،4،5،6،7،8-octahydro-1،4-dimethyl-7- (1-methylethylidene)-، (1S،4S)-؛ Guaiene، بتا؛ 1،4-دی متیل-7- (پروپان-2-ایلین) -1،2،3،4،5،6،7،8-اکتا هیدروازولین؛ |
| نام انگلیسی | (1S-cis)-1,2,3,4,5,6,7,8-octahydro-7-isopropylidene-1,4-dimethylazulene;Guaiene;1,2,3,4,5,6,7,8-Octahydro-1,4-dimethyl-7-(1-methylethylidene)-azulene, (1S,cis);Azulene, 1,2,3,4,5,6,7,8-octahydro-1,4-dimethyl-7-(1-methylethylidene)-, (1S-cis)-;Guaia-1(5),7(11)-diene;(1S-cis)-1,2,3,4,5,6,7,8-Octahydro-7-isopropylidene-1,4-dimethylazulene;Azulene, 1,2,3,4,5,6,7,8-octahydro-1,4-dimethyl-7-(1-methylethylidene)-, (1S,4S)-;Guaiene, beta-;1,4-dimethyl-7-(propan-2-ylidene)-1,2,3,4,5,6,7,8-octahydroazulene |
| میدان مغناطیسی | C15H24 |
| وزن مولکولی | 204.3511 |
| InChI | InChI=1/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-12H,5-9H2,1-4H3/t11-,12-/m0/s1 |
| شماره سیایاس | 88-84-6 |
| تعداد کمیسیون اروپایی | 201-860-1 |
| ساختار مولکولی | ![]() |
| ضریب شکست | 1.498 |
| MSDS | |