ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-84-6 (1S-cis)-1,2,3,4,5,6,7,8-옥타하이드로-7-이소프로필리덴-1,4-디메틸아줄렌 |
|
| 상품명칭 | (1S-cis)-1,2,3,4,5,6,7,8-옥타하이드로-7-이소프로필리덴-1,4-디메틸아줄렌 |
| 별명 | 과이에네; 1,2,3,4,5,6,7,8-옥타하이드로-1,4-디메틸-7-(1-메틸에틸리덴)-아줄렌, (1S,cis); 아줄렌, 1,2,3,4,5,6,7,8-옥타하이드로-1,4-디메틸-7-(1-메틸에틸리덴)-, (1S-cis)-; Guaia-1 (5), 7 (11) - 디엔; (1S-cis)-1,2,3,4,5,6,7,8-옥타하이드로-7-이소프로필리덴-1,4-디메틸아줄렌; 아줄렌, 1,2,3,4,5,6,7,8-옥타하이드로-1,4-디메틸-7-(1-메틸에틸리덴)-, (1S,4S)-; Guaiene, 베타-; 1,4- 디메틸 -7- (프로 판 -2- 일리 덴) -1,2,3,4,5,6,7,8- 옥타 하이드로 아줄렌; |
| 영문 이름 | (1S-cis)-1,2,3,4,5,6,7,8-octahydro-7-isopropylidene-1,4-dimethylazulene;Guaiene;1,2,3,4,5,6,7,8-Octahydro-1,4-dimethyl-7-(1-methylethylidene)-azulene, (1S,cis);Azulene, 1,2,3,4,5,6,7,8-octahydro-1,4-dimethyl-7-(1-methylethylidene)-, (1S-cis)-;Guaia-1(5),7(11)-diene;(1S-cis)-1,2,3,4,5,6,7,8-Octahydro-7-isopropylidene-1,4-dimethylazulene;Azulene, 1,2,3,4,5,6,7,8-octahydro-1,4-dimethyl-7-(1-methylethylidene)-, (1S,4S)-;Guaiene, beta-;1,4-dimethyl-7-(propan-2-ylidene)-1,2,3,4,5,6,7,8-octahydroazulene |
| 분자식 | C15H24 |
| 분자량 | 204.3511 |
| InChI | InChI=1/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-12H,5-9H2,1-4H3/t11-,12-/m0/s1 |
| cas번호 | 88-84-6 |
| EC번호 | 201-860-1 |
| 분자 구조 | ![]() |
| 굴절 지수 | 1.498 |
| MSDS | |