ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone |
|
| نام محصول | 2-Hydroxy-4,6-dimethoxyacetophenone |
| نام انگلیسی | 2-Hydroxy-4,6-dimethoxyacetophenone;xanthoxylin |
| میدان مغناطیسی | C10H12O4 |
| وزن مولکولی | 196.1999 |
| InChI | InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| شماره سیایاس | 90-24-4 |
| تعداد کمیسیون اروپایی | 201-978-3 |
| ساختار مولکولی | ![]() |
| تراکم | 1.172g/cm3 |
| نقطه ذوب | 80-82℃ |
| نقطه غلیان | 355.1°C at 760 mmHg |
| ضریب شکست | 1.527 |
| نقطه اشتعال | 141.2°C |
| فشار بخار | 1.57E-05mmHg at 25°C |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |