ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone |
|
| Nome del prodotto | 2-Hydroxy-4,6-dimethoxyacetophenone |
| Nome inglese | 2-Hydroxy-4,6-dimethoxyacetophenone;xanthoxylin |
| Formula molecolare | C10H12O4 |
| Peso Molecolare | 196.1999 |
| InChI | InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| Numero CAS | 90-24-4 |
| EINECS | 201-978-3 |
| Struttura molecolare | ![]() |
| Densità | 1.172g/cm3 |
| Punto di fusione | 80-82℃ |
| Punto di ebollizione | 355.1°C at 760 mmHg |
| Indice di rifrazione | 1.527 |
| Punto d'infiammabilità | 141.2°C |
| Pressione di vapore | 1.57E-05mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |