ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
150114-69-5 3,4,5-Trimethoxyphenylglyoxal hydrate |
|
| Nome del prodotto | 3,4,5-Trimethoxyphenylglyoxal hydrate |
| Nome inglese | 3,4,5-Trimethoxyphenylglyoxal hydrate;2-oxo-2-(3,4,5-trimethoxyphenyl)acetaldehyde hydrate |
| Formula molecolare | C11H14O6 |
| Peso Molecolare | 242.2253 |
| InChI | InChI=1/C11H12O5.H2O/c1-14-9-4-7(8(13)6-12)5-10(15-2)11(9)16-3;/h4-6H,1-3H3;1H2 |
| Numero CAS | 150114-69-5 |
| Struttura molecolare | ![]() |
| Punto di ebollizione | 424.8°C at 760 mmHg |
| Punto d'infiammabilità | 210.7°C |
| Pressione di vapore | 5.63E-08mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |