ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
150114-69-5 3,4,5-Trimethoxyphenylglyoxal hydrate |
|
| Naam product | 3,4,5-Trimethoxyphenylglyoxal hydrate |
| Engelse naam | 3,4,5-Trimethoxyphenylglyoxal hydrate;2-oxo-2-(3,4,5-trimethoxyphenyl)acetaldehyde hydrate |
| MF | C11H14O6 |
| Molecuulgewicht | 242.2253 |
| InChI | InChI=1/C11H12O5.H2O/c1-14-9-4-7(8(13)6-12)5-10(15-2)11(9)16-3;/h4-6H,1-3H3;1H2 |
| CAS-nummer | 150114-69-5 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 424.8°C at 760 mmHg |
| Vlampunt | 210.7°C |
| Dampdruk | 5.63E-08mmHg at 25°C |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |