ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203302-88-9 Glicina n-pentil estere cloridrato |
|
Nome del prodotto | Glicina n-pentil estere cloridrato |
Nome inglese | Glycine n-pentyl ester hydrochloride; |
Formula molecolare | C7H16ClNO2 |
Peso Molecolare | 181.6604 |
InChI | InChI=1/C7H15NO2.ClH/c1-2-3-4-5-10-7(9)6-8;/h2-6,8H2,1H3;1H |
Numero CAS | 203302-88-9 |
Struttura molecolare | ![]() |
Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |