ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203302-88-9 Glycine n-pentyl ester hydrochloride |
|
Nama produk | Glycine n-pentyl ester hydrochloride |
Nama Inggeris | Glycine n-pentyl ester hydrochloride; |
MF | C7H16ClNO2 |
Berat Molekul | 181.6604 |
InChI | InChI=1/C7H15NO2.ClH/c1-2-3-4-5-10-7(9)6-8;/h2-6,8H2,1H3;1H |
CAS NO | 203302-88-9 |
Struktur Molekul | ![]() |
Keselamatan Penerangan | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |