ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23780-13-4 (2-phenyl-1,3-thiazol-4-yl)methanol |
|
| Nome del prodotto | (2-phenyl-1,3-thiazol-4-yl)methanol |
| Nome inglese | (2-phenyl-1,3-thiazol-4-yl)methanol;(2-Phenyl-thiazol-4-yl)-methanol |
| Formula molecolare | C10H9NOS |
| Peso Molecolare | 191.2496 |
| InChI | InChI=1/C10H9NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-5,7,12H,6H2 |
| Numero CAS | 23780-13-4 |
| Struttura molecolare | ![]() |
| Densità | 1.264g/cm3 |
| Punto di fusione | 67℃ |
| Punto di ebollizione | 372.2°C at 760 mmHg |
| Indice di rifrazione | 1.629 |
| Punto d'infiammabilità | 178.9°C |
| Pressione di vapore | 3.37E-06mmHg at 25°C |
| Codici di Rischio | R24/25##Toxic in contact with skin and if swallowed.:; |
| MSDS | |