ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23780-13-4 (2-phenyl-1,3-thiazol-4-yl)methanol |
|
produktnavn | (2-phenyl-1,3-thiazol-4-yl)methanol |
Engelsk navn | (2-phenyl-1,3-thiazol-4-yl)methanol;(2-Phenyl-thiazol-4-yl)-methanol |
Molekylær Formel | C10H9NOS |
Molekylvekt | 191.2496 |
InChI | InChI=1/C10H9NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-5,7,12H,6H2 |
CAS-nummer | 23780-13-4 |
Molecular Structure | ![]() |
Tetthet | 1.264g/cm3 |
Smeltepunkt | 67℃ |
Kokepunkt | 372.2°C at 760 mmHg |
Brytningsindeks | 1.629 |
Flammepunktet | 178.9°C |
Damptrykk | 3.37E-06mmHg at 25°C |
Risiko Koder | R24/25##Toxic in contact with skin and if swallowed.:; |
MSDS |