ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
312973-24-3 3-Formylindole-7-carboxylic acid methyl ester |
|
| Nome del prodotto | 3-Formylindole-7-carboxylic acid methyl ester |
| Nome inglese | 3-Formylindole-7-carboxylic acid methyl ester;1H-indole-7-carboxylic acid, 3-formyl-, methyl ester;Methyl 3-formyl-1H-indole-7-carboxylate |
| Formula molecolare | C11H9NO3 |
| Peso Molecolare | 203.1941 |
| InChI | InChI=1/C11H9NO3/c1-15-11(14)9-4-2-3-8-7(6-13)5-12-10(8)9/h2-6,12H,1H3 |
| Numero CAS | 312973-24-3 |
| Struttura molecolare | ![]() |
| Densità | 1.341g/cm3 |
| Punto di ebollizione | 404.4°C at 760 mmHg |
| Indice di rifrazione | 1.677 |
| Punto d'infiammabilità | 198.4°C |
| Pressione di vapore | 9.46E-07mmHg at 25°C |
| MSDS | |