ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
312973-24-3 3-Formylindole-7-carboxylic acid methyl ester |
|
| Ürün Adı | 3-Formylindole-7-carboxylic acid methyl ester |
| ingilizce adı | 3-Formylindole-7-carboxylic acid methyl ester;1H-indole-7-carboxylic acid, 3-formyl-, methyl ester;Methyl 3-formyl-1H-indole-7-carboxylate |
| Moleküler Formülü | C11H9NO3 |
| Molekül Ağırlığı | 203.1941 |
| InChI | InChI=1/C11H9NO3/c1-15-11(14)9-4-2-3-8-7(6-13)5-12-10(8)9/h2-6,12H,1H3 |
| CAS kayıt numarası | 312973-24-3 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.341g/cm3 |
| Kaynama noktası | 404.4°C at 760 mmHg |
| Kırılma indisi | 1.677 |
| Alevlenme noktası | 198.4°C |
| Buhar basıncı | 9.46E-07mmHg at 25°C |
| MSDS | |