ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
441-38-3 alpha-Benzoin oxime |
|
| Nome del prodotto | alpha-Benzoin oxime |
| Nome inglese | alpha-Benzoin oxime;2-Hydroxy-1,2-diphenylethanone oxime (alpha-form);a-Benzoin oxime, (Cupron);(1E)-2-hydroxy-1,2-diphenylethanone oxime;(1Z)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1E,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2R)-2-hydroxy-1,2-diphenylethanone oxime;α-Benzoin oxime;Benzoin α-oxime |
| Formula molecolare | C14H13NO2 |
| Peso Molecolare | 227.2585 |
| InChI | InChI=1/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13-/t14-/m1/s1 |
| Numero CAS | 441-38-3 |
| EINECS | 207-127-2 |
| Struttura molecolare | ![]() |
| Densità | 1.13g/cm3 |
| Punto di fusione | 150-155℃ |
| Punto di ebollizione | 417.8°C at 760 mmHg |
| Indice di rifrazione | 1.58 |
| Punto d'infiammabilità | 270.4°C |
| Pressione di vapore | 9.98E-08mmHg at 25°C |
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |