ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
441-38-3 alpha-Benzoin oxime | 
    |
| Naam product | alpha-Benzoin oxime | 
| Engelse naam | alpha-Benzoin oxime;2-Hydroxy-1,2-diphenylethanone oxime (alpha-form);a-Benzoin oxime, (Cupron);(1E)-2-hydroxy-1,2-diphenylethanone oxime;(1Z)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1E,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2R)-2-hydroxy-1,2-diphenylethanone oxime;α-Benzoin oxime;Benzoin α-oxime | 
| MF | C14H13NO2 | 
| Molecuulgewicht | 227.2585 | 
| InChI | InChI=1/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13-/t14-/m1/s1 | 
| CAS-nummer | 441-38-3 | 
| EINECS | 207-127-2 | 
| Moleculaire Structuur | ![]()  | 
    
| Dichtheid | 1.13g/cm3 | 
| Smeltpunt | 150-155℃ | 
| Kookpunt | 417.8°C at 760 mmHg | 
| Brekingsindex | 1.58 | 
| Vlampunt | 270.4°C | 
| Dampdruk | 9.98E-08mmHg at 25°C | 
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |