ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-59-6 4-Fluoro-N-methylaniline |
|
| Nome del prodotto | 4-Fluoro-N-methylaniline |
| Nome inglese | 4-Fluoro-N-methylaniline;4-Fluoro-N-toluidine |
| Formula molecolare | C7H8FN |
| Peso Molecolare | 125.1435 |
| InChI | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| Numero CAS | 459-59-6 |
| EINECS | 207-294-1 |
| Struttura molecolare | ![]() |
| Densità | 1.106g/cm3 |
| Punto di ebollizione | 181.4°C at 760 mmHg |
| Indice di rifrazione | 1.546 |
| Punto d'infiammabilità | 63.5°C |
| Pressione di vapore | 0.853mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |