ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-59-6 4-Fluoro-N-methylaniline |
|
| produktnavn | 4-Fluoro-N-methylaniline |
| Engelsk navn | 4-Fluoro-N-methylaniline;4-Fluoro-N-toluidine |
| Molekylær Formel | C7H8FN |
| Molekylvekt | 125.1435 |
| InChI | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| CAS-nummer | 459-59-6 |
| EINECS | 207-294-1 |
| Molecular Structure | ![]() |
| Tetthet | 1.106g/cm3 |
| Kokepunkt | 181.4°C at 760 mmHg |
| Brytningsindeks | 1.546 |
| Flammepunktet | 63.5°C |
| Damptrykk | 0.853mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |