ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50670-50-3 4'-methyl[1,1'-biphenyl]-4-carbonitrile |
|
| Nome del prodotto | 4'-methyl[1,1'-biphenyl]-4-carbonitrile |
| Nome inglese | 4'-methyl[1,1'-biphenyl]-4-carbonitrile;4'-Cyano-4-methylbiphenyl;4'-methylbiphenyl-4-carbonitrile;4-Cyano-4'-Methylbiphenyl |
| Formula molecolare | C14H11N |
| Peso Molecolare | 193.2438 |
| InChI | InChI=1/C14H11N/c1-11-2-6-13(7-3-11)14-8-4-12(10-15)5-9-14/h2-9H,1H3 |
| Numero CAS | 50670-50-3 |
| EINECS | 256-701-9 |
| Struttura molecolare | ![]() |
| Densità | 1.09g/cm3 |
| Punto di ebollizione | 343.5°C at 760 mmHg |
| Indice di rifrazione | 1.604 |
| Punto d'infiammabilità | 162.3°C |
| Pressione di vapore | 7E-05mmHg at 25°C |
| MSDS | |