ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50670-50-3 4'-methyl[1,1'-biphenyl]-4-carbonitrile |
|
| Naam product | 4'-methyl[1,1'-biphenyl]-4-carbonitrile |
| Engelse naam | 4'-methyl[1,1'-biphenyl]-4-carbonitrile;4'-Cyano-4-methylbiphenyl;4'-methylbiphenyl-4-carbonitrile;4-Cyano-4'-Methylbiphenyl |
| MF | C14H11N |
| Molecuulgewicht | 193.2438 |
| InChI | InChI=1/C14H11N/c1-11-2-6-13(7-3-11)14-8-4-12(10-15)5-9-14/h2-9H,1H3 |
| CAS-nummer | 50670-50-3 |
| EINECS | 256-701-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.09g/cm3 |
| Kookpunt | 343.5°C at 760 mmHg |
| Brekingsindex | 1.604 |
| Vlampunt | 162.3°C |
| Dampdruk | 7E-05mmHg at 25°C |
| MSDS | |