ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50722-62-8 4-nitroso-4-azatricyclo[4.3.1.1~3,8~]undecan-5-one |
|
| Nome del prodotto | 4-nitroso-4-azatricyclo[4.3.1.1~3,8~]undecan-5-one |
| Nome inglese | 4-nitroso-4-azatricyclo[4.3.1.1~3,8~]undecan-5-one; |
| Formula molecolare | C10H14N2O2 |
| Peso Molecolare | 194.2304 |
| InChI | InChI=1/C10H14N2O2/c13-10-8-2-6-1-7(3-8)5-9(4-6)12(10)11-14/h6-9H,1-5H2 |
| Numero CAS | 50722-62-8 |
| Struttura molecolare | ![]() |
| Densità | 1.64g/cm3 |
| Punto di ebollizione | 291.5°C at 760 mmHg |
| Indice di rifrazione | 1.783 |
| Punto d'infiammabilità | 130.1°C |
| Pressione di vapore | 0.00194mmHg at 25°C |
| MSDS | |