ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50722-62-8 4-nitroso-4-azatricyclo[4.3.1.1~3,8~]undecan-5-one |
|
| Naam product | 4-nitroso-4-azatricyclo[4.3.1.1~3,8~]undecan-5-one |
| Engelse naam | 4-nitroso-4-azatricyclo[4.3.1.1~3,8~]undecan-5-one; |
| MF | C10H14N2O2 |
| Molecuulgewicht | 194.2304 |
| InChI | InChI=1/C10H14N2O2/c13-10-8-2-6-1-7(3-8)5-9(4-6)12(10)11-14/h6-9H,1-5H2 |
| CAS-nummer | 50722-62-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.64g/cm3 |
| Kookpunt | 291.5°C at 760 mmHg |
| Brekingsindex | 1.783 |
| Vlampunt | 130.1°C |
| Dampdruk | 0.00194mmHg at 25°C |
| MSDS | |