ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50907-31-8 5-(2,6-Dichlorophenyl)-1H-tetrazole |
|
| Nome del prodotto | 5-(2,6-Dichlorophenyl)-1H-tetrazole |
| Nome inglese | 5-(2,6-Dichlorophenyl)-1H-tetrazole;5-(2-Fluorophenyl)-1H-tetrazole;5-(2,6-dichlorophenyl)-2H-tetrazole |
| Formula molecolare | C7H4Cl2N4 |
| Peso Molecolare | 215.0395 |
| InChI | InChI=1/C7H4Cl2N4/c8-4-2-1-3-5(9)6(4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
| Numero CAS | 50907-31-8 |
| Struttura molecolare | ![]() |
| Densità | 1.574g/cm3 |
| Punto di ebollizione | 399.9°C at 760 mmHg |
| Indice di rifrazione | 1.641 |
| Punto d'infiammabilità | 227.9°C |
| Pressione di vapore | 1.32E-06mmHg at 25°C |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |